C24H27NO2 — CID 101235687
tert-butyl (3R)-3-(benzylamino)-3-naphthalen-1-ylpropanoate (PubChem CID 101235687) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl (3R)-3-(benzylamino)-3-naphthalen-1-ylpropanoate.
| Compound Name | tert-butyl (3R)-3-(benzylamino)-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 101235687 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl (3R)-3-(benzylamino)-3-naphthalen-1-ylpropanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](NCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27NO2/c1-24(2,3)27-23(26)16-22(25-17-18-10-5-4-6-11-18)21-15-9-13-19-12-7-8-14-20(19)21/h4-15,22,25H,16-17H2,1-3H3/t22-/m1/s1 |
| InChIKey | CEHJYLKKUAAJKA-JOCHJYFZSA-N |
| XLogP | 5.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |