C25H45NO3Si — CID 10599023
tert-butyl (3S,4S)-3-(benzylamino)-4-tri(propan-2-yl)silyloxypentanoate (PubChem CID 10599023) has the molecular formula C25H45NO3Si and a molecular weight of 435.73 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-(benzylamino)-4-tri(propan-2-yl)silyloxypentanoate.
| Compound Name | tert-butyl (3S,4S)-3-(benzylamino)-4-tri(propan-2-yl)silyloxypentanoate |
|---|---|
| PubChem CID | 10599023 |
| Molecular Formula | C25H45NO3Si |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | tert-butyl (3S,4S)-3-(benzylamino)-4-tri(propan-2-yl)silyloxypentanoate |
| SMILES | CC(C)[Si](O[C@@H](C)[C@H](CC(=O)OC(C)(C)C)NCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H45NO3Si/c1-18(2)30(19(3)4,20(5)6)29-21(7)23(16-24(27)28-25(8,9)10)26-17-22-14-12-11-13-15-22/h11-15,18-21,23,26H,16-17H2,1-10H3/t21-,23-/m0/s1 |
| InChIKey | MYAFMVMZSMPMNT-GMAHTHKFSA-N |
| XLogP | 6.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|