About tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate
tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate (PubChem CID 18465678) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate.
Molecular Properties
| Compound Name | tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate |
| PubChem CID | 18465678 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CC(NCc1ccccc1)C1COC(C)(C)O1 |
| InChI | InChI=1S/C19H29NO4/c1-18(2,3)24-17(21)11-15(16-13-22-19(4,5)23-16)20-12-14-9-7-6-8-10-14/h6-10,15-16,20H,11-13H2,1-5H3 |
| InChIKey | VFYNQCSTPYTEDM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate?
The IUPAC name of tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate (CID 18465678) is tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate.
What is the SMILES notation for tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate?
The canonical SMILES for tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate is CC(C)(C)OC(=O)CC(NCc1ccccc1)C1COC(C)(C)O1.
What is the InChIKey of tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate?
The InChIKey is VFYNQCSTPYTEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO4/c1-18(2,3)24-17(21)11-15(16-13-22-19(4,5)23-16)20-12-14-9-7-6-8-10-14/h6-10,15-16,20H,11-13H2,1-5H3.
What are the key properties of tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate?
tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate has a molecular weight of 335.44 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(benzylamino)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propanoate is sourced from PubChem (CID 18465678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).