C21H25NO3S — CID 10044748
S-(4-methylphenyl) (2R)-2-(benzylamino)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanethioate (PubChem CID 10044748) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is S-(4-methylphenyl) (2R)-2-(benzylamino)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanethioate.
| Compound Name | S-(4-methylphenyl) (2R)-2-(benzylamino)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanethioate |
|---|---|
| PubChem CID | 10044748 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | S-(4-methylphenyl) (2R)-2-(benzylamino)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanethioate |
| SMILES | Cc1ccc(SC(=O)[C@H](NCc2ccccc2)[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-15-9-11-17(12-10-15)26-20(23)19(18-14-24-21(2,3)25-18)22-13-16-7-5-4-6-8-16/h4-12,18-19,22H,13-14H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | RDJFZLOZHWAHHO-RTBURBONSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|