C22H28O3S2 — CID 11143928
(1R)-3,3-bis(benzylsulfanyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol (PubChem CID 11143928) has the molecular formula C22H28O3S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is (1R)-3,3-bis(benzylsulfanyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol.
| Compound Name | (1R)-3,3-bis(benzylsulfanyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 11143928 |
| Molecular Formula | C22H28O3S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (1R)-3,3-bis(benzylsulfanyl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
| SMILES | CC1(C)OC[C@@H]([C@H](O)CC(SCc2ccccc2)SCc2ccccc2)O1 |
| InChI | InChI=1S/C22H28O3S2/c1-22(2)24-14-20(25-22)19(23)13-21(26-15-17-9-5-3-6-10-17)27-16-18-11-7-4-8-12-18/h3-12,19-21,23H,13-16H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | UFFWYKXOCBPKMQ-UXHICEINSA-N |
| XLogP | 5.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|