C11H20O5 — CID 4047032
bis(2,2-dimethyl-1,3-dioxolan-4-yl)methanol (PubChem CID 4047032) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is bis(2,2-dimethyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | bis(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 4047032 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | bis(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CC1(C)OCC(C(O)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C11H20O5/c1-10(2)13-5-7(15-10)9(12)8-6-14-11(3,4)16-8/h7-9,12H,5-6H2,1-4H3 |
| InChIKey | NQJMKBQMFSCMFO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |