C7H11Cl3O3 — CID 59052003
(1R)-2,2,2-trichloro-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 59052003) has the molecular formula C7H11Cl3O3 and a molecular weight of 249.52 g/mol. Its IUPAC name is (1R)-2,2,2-trichloro-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2,2,2-trichloro-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 59052003 |
| Molecular Formula | C7H11Cl3O3 |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | (1R)-2,2,2-trichloro-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)OC[C@@H]([C@@H](O)C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C7H11Cl3O3/c1-6(2)12-3-4(13-6)5(11)7(8,9)10/h4-5,11H,3H2,1-2H3/t4-,5+/m0/s1 |
| InChIKey | ALHXAMFLMOLBEY-CRCLSJGQSA-N |
| XLogP | 1.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|