C8H13F3O4 — CID 173017765
(2,2-dimethyl-1,3-dioxolan-4-yl)-(2,2,2-trifluoroethoxy)methanol (PubChem CID 173017765) has the molecular formula C8H13F3O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)-(2,2,2-trifluoroethoxy)methanol.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-(2,2,2-trifluoroethoxy)methanol |
|---|---|
| PubChem CID | 173017765 |
| Molecular Formula | C8H13F3O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)-(2,2,2-trifluoroethoxy)methanol |
| SMILES | CC1(C)OCC(C(O)OCC(F)(F)F)O1 |
| InChI | InChI=1S/C8H13F3O4/c1-7(2)14-3-5(15-7)6(12)13-4-8(9,10)11/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | LXCNVFQFBGBCPG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|