C9H15ClO5 — CID 175078711
2-chloro-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylpropanoic acid (PubChem CID 175078711) has the molecular formula C9H15ClO5 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-chloro-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylpropanoic acid.
| Compound Name | 2-chloro-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175078711 |
| Molecular Formula | C9H15ClO5 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-chloro-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylpropanoic acid |
| SMILES | CC1(C)OC[C@H](C(O)C(C)(Cl)C(=O)O)O1 |
| InChI | InChI=1S/C9H15ClO5/c1-8(2)14-4-5(15-8)6(11)9(3,10)7(12)13/h5-6,11H,4H2,1-3H3,(H,12,13)/t5-,6?,9?/m1/s1 |
| InChIKey | NXDIQHZHCNIHBG-ZZCQVLGYSA-N |
| XLogP | 0.58 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|