C10H18O5 — CID 71435688
acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol (PubChem CID 71435688) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol.
| Compound Name | acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 71435688 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)C1COC(C)(C)O1.CC(=O)O |
| InChI | InChI=1S/C8H14O3.C2H4O2/c1-4-6(9)7-5-10-8(2,3)11-7;1-2(3)4/h4,6-7,9H,1,5H2,2-3H3;1H3,(H,3,4) |
| InChIKey | FMRNVQYIZYACEK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|