acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol

C10H18O5 — CID 71435688

IUPACacetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol
SMILESC=CC(O)C1COC(C)(C)O1.CC(=O)O
InChIInChI=1S/C8H14O3.C2H4O2/c1-4-6(9)7-5-10-8(2,3)11-7;1-2(3)4/h4,6-7,9H,1,5H2,2-3H3;1H3,(H,3,4)
InChIKeyFMRNVQYIZYACEK-UHFFFAOYSA-N
MW218.25 g/mol
LogP0.78
Rot. Bonds2

About acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol

acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol (PubChem CID 71435688) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol.

Molecular Properties

Compound Nameacetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol
PubChem CID71435688
Molecular FormulaC10H18O5
Molecular Weight218.25 g/mol
Exact Mass218.12
IUPAC Nameacetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol
SMILESC=CC(O)C1COC(C)(C)O1.CC(=O)O
InChIInChI=1S/C8H14O3.C2H4O2/c1-4-6(9)7-5-10-8(2,3)11-7;1-2(3)4/h4,6-7,9H,1,5H2,2-3H3;1H3,(H,3,4)
InChIKeyFMRNVQYIZYACEK-UHFFFAOYSA-N
XLogP0.78
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 50.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol?
The IUPAC name of acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol (CID 71435688) is acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol.
What is the SMILES notation for acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol?
The canonical SMILES for acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol is C=CC(O)C1COC(C)(C)O1.CC(=O)O.
What is the InChIKey of acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol?
The InChIKey is FMRNVQYIZYACEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.C2H4O2/c1-4-6(9)7-5-10-8(2,3)11-7;1-2(3)4/h4,6-7,9H,1,5H2,2-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol?
acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol has a molecular weight of 218.25 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-en-1-ol is sourced from PubChem (CID 71435688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).