C12H20F2O4S — CID 134990555
S-tert-butyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanethioate (PubChem CID 134990555) has the molecular formula C12H20F2O4S and a molecular weight of 298.35 g/mol. Its IUPAC name is S-tert-butyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanethioate.
| Compound Name | S-tert-butyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanethioate |
|---|---|
| PubChem CID | 134990555 |
| Molecular Formula | C12H20F2O4S |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | S-tert-butyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanethioate |
| SMILES | CC1(C)OC[C@H](C(O)C(F)(F)C(=O)SC(C)(C)C)O1 |
| InChI | InChI=1S/C12H20F2O4S/c1-10(2,3)19-9(16)12(13,14)8(15)7-6-17-11(4,5)18-7/h7-8,15H,6H2,1-5H3/t7-,8?/m1/s1 |
| InChIKey | SFJPYAUFBBFZCS-GVHYBUMESA-N |
| XLogP | 2.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|