C13H22O6 — CID 69412912
2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid (PubChem CID 69412912) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid.
| Compound Name | 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 69412912 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid |
| SMILES | CC1(C)OCC(C(C)(C(=O)O)C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H22O6/c1-11(2)16-6-8(18-11)13(5,10(14)15)9-7-17-12(3,4)19-9/h8-9H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | IPWAJODYCVQKKH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |