2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid

C13H22O6 — CID 69412912

IUPAC2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
SMILESCC1(C)OCC(C(C)(C(=O)O)C2COC(C)(C)O2)O1
InChIInChI=1S/C13H22O6/c1-11(2)16-6-8(18-11)13(5,10(14)15)9-7-17-12(3,4)19-9/h8-9H,6-7H2,1-5H3,(H,14,15)
InChIKeyIPWAJODYCVQKKH-UHFFFAOYSA-N
MW274.31 g/mol
LogP1.38
Rot. Bonds3

About 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid

2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid (PubChem CID 69412912) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid.

Molecular Properties

Compound Name2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
PubChem CID69412912
Molecular FormulaC13H22O6
Molecular Weight274.31 g/mol
Exact Mass274.14
IUPAC Name2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
SMILESCC1(C)OCC(C(C)(C(=O)O)C2COC(C)(C)O2)O1
InChIInChI=1S/C13H22O6/c1-11(2)16-6-8(18-11)13(5,10(14)15)9-7-17-12(3,4)19-9/h8-9H,6-7H2,1-5H3,(H,14,15)
InChIKeyIPWAJODYCVQKKH-UHFFFAOYSA-N
XLogP1.38
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.31
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The IUPAC name of 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid (CID 69412912) is 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid.
What is the SMILES notation for 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The canonical SMILES for 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid is CC1(C)OCC(C(C)(C(=O)O)C2COC(C)(C)O2)O1.
What is the InChIKey of 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The InChIKey is IPWAJODYCVQKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O6/c1-11(2)16-6-8(18-11)13(5,10(14)15)9-7-17-12(3,4)19-9/h8-9H,6-7H2,1-5H3,(H,14,15).
What are the key properties of 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid has a molecular weight of 274.31 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid is sourced from PubChem (CID 69412912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).