About potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride
potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride (PubChem CID 173083628) has the molecular formula C6H11KO4
and a molecular weight of 186.25 g/mol. Its IUPAC name is potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride.
Molecular Properties
| Compound Name | potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride |
| PubChem CID | 173083628 |
| Molecular Formula | C6H11KO4 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride |
| SMILES | CC1(C)OC[C@H](C(=O)O)O1.[H-].[K+] |
| InChI | InChI=1S/C6H10O4.K.H/c1-6(2)9-3-4(10-6)5(7)8;;/h4H,3H2,1-2H3,(H,7,8);;/q;+1;-1/t4-;;/m1../s1 |
| InChIKey | NWRDAUQGBOUJHS-RZFWHQLPSA-N |
| XLogP | -2.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride?
The IUPAC name of potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride (CID 173083628) is potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride.
What is the SMILES notation for potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride?
The canonical SMILES for potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride is CC1(C)OC[C@H](C(=O)O)O1.[H-].[K+].
What is the InChIKey of potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride?
The InChIKey is NWRDAUQGBOUJHS-RZFWHQLPSA-N. The full InChI is InChI=1S/C6H10O4.K.H/c1-6(2)9-3-4(10-6)5(7)8;;/h4H,3H2,1-2H3,(H,7,8);;/q;+1;-1/t4-;;/m1../s1.
What are the key properties of potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride?
potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride has a molecular weight of 186.25 g/mol, XLogP of -2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydride is sourced from PubChem (CID 173083628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).