About 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride
2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride (PubChem CID 69349368) has the molecular formula C6H11ClO4
and a molecular weight of 182.60 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride.
Analyze 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride?
The IUPAC name of 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride (CID 69349368) is 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride.
What is the SMILES notation for 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride?
The canonical SMILES for 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride is CC1(C)OCC(C(=O)O)O1.Cl.
What is the InChIKey of 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride?
The InChIKey is ZLFPIPJBVGYOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.ClH/c1-6(2)9-3-4(10-6)5(7)8;/h4H,3H2,1-2H3,(H,7,8);1H.
What are the key properties of 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride?
2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride has a molecular weight of 182.60 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 69349368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).