C9H14O4 — CID 126712187
(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxane-4-carboxylic acid (PubChem CID 126712187) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxane-4-carboxylic acid.
| Compound Name | (4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxane-4-carboxylic acid |
|---|---|
| PubChem CID | 126712187 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxane-4-carboxylic acid |
| SMILES | C=C[C@@H]1COC(C)(C)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H14O4/c1-4-6-5-12-9(2,3)13-7(6)8(10)11/h4,6-7H,1,5H2,2-3H3,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | RZHZLMOJXILMGX-RQJHMYQMSA-N |
| XLogP | 1.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|