C18H26O7 — CID 102400344
[(1R)-1-[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]but-3-enyl] prop-2-enoate (PubChem CID 102400344) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(1R)-1-[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]but-3-enyl] prop-2-enoate.
| Compound Name | [(1R)-1-[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]but-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 102400344 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(1R)-1-[(1R,2S,6S,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]but-3-enyl] prop-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C=C)[C@@]12O[C@H]3COC(C)(C)O[C@H]3[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C18H26O7/c1-7-9-12(21-13(19)8-2)18-15(24-17(5,6)25-18)14-11(22-18)10-20-16(3,4)23-14/h7-8,11-12,14-15H,1-2,9-10H2,3-6H3/t11-,12+,14+,15-,18-/m0/s1 |
| InChIKey | HTAITXCLRVUPFM-DOUNWEIKSA-N |
| XLogP | 2.06 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|