C12H18O8 — CID 101471992
(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboperoxoic acid (PubChem CID 101471992) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboperoxoic acid.
| Compound Name | (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboperoxoic acid |
|---|---|
| PubChem CID | 101471992 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboperoxoic acid |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(C(=O)OO)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H18O8/c1-10(2)15-5-6-7(17-10)8-12(16-6,9(13)19-14)20-11(3,4)18-8/h6-8,14H,5H2,1-4H3/t6-,7+,8-,12+/m0/s1 |
| InChIKey | PLTDNMLJRLQQCJ-FLNNQWSLSA-N |
| XLogP | 0.40 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|