C25H28O8 — CID 101353568
(3-phenoxyphenyl)methyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate (PubChem CID 101353568) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
|---|---|
| PubChem CID | 101353568 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (3-phenoxyphenyl)methyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(C(=O)OCc4cccc(Oc5ccccc5)c4)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C25H28O8/c1-23(2)28-15-19-20(31-23)21-25(30-19,33-24(3,4)32-21)22(26)27-14-16-9-8-12-18(13-16)29-17-10-6-5-7-11-17/h5-13,19-21H,14-15H2,1-4H3/t19-,20+,21-,25+/m0/s1 |
| InChIKey | VJMIHKPSGKISBQ-UGCAPWQASA-N |
| XLogP | 3.92 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |