C15H18O5 — CID 15977501
benzyl (4R,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolane-4-carboxylate (PubChem CID 15977501) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is benzyl (4R,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolane-4-carboxylate.
| Compound Name | benzyl (4R,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 15977501 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | benzyl (4R,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolane-4-carboxylate |
| SMILES | CC1(C)O[C@H]([C@@H]2CO2)[C@H](C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C15H18O5/c1-15(2)19-12(11-9-17-11)13(20-15)14(16)18-8-10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | WPHXZHYGHWLONB-YNEHKIRRSA-N |
| XLogP | 1.65 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|