C18H26O10 — CID 134446873
oxiran-2-ylmethyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 134446873) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is oxiran-2-ylmethyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | oxiran-2-ylmethyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134446873 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | oxiran-2-ylmethyl (4R,5S)-5-[(4R,5S)-2,2-dimethyl-5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC1(C)O[C@H]([C@@H]2OC(C)(C)O[C@H]2C(=O)OCC2CO2)[C@@H](C(=O)OCC2CO2)O1 |
| InChI | InChI=1S/C18H26O10/c1-17(2)25-11(13(27-17)15(19)23-7-9-5-21-9)12-14(28-18(3,4)26-12)16(20)24-8-10-6-22-10/h9-14H,5-8H2,1-4H3/t9?,10?,11-,12+,13+,14- |
| InChIKey | ZSPOPTCXJQFLNA-RGPJTXMSSA-N |
| XLogP | -0.09 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|