C11H14O6 — CID 23069347
bis(oxiran-2-ylmethyl) cyclopropane-1,2-dicarboxylate (PubChem CID 23069347) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) cyclopropane-1,2-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23069347 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | bis(oxiran-2-ylmethyl) cyclopropane-1,2-dicarboxylate |
| SMILES | O=C(OCC1CO1)C1CC1C(=O)OCC1CO1 |
| InChI | InChI=1S/C11H14O6/c12-10(16-4-6-2-14-6)8-1-9(8)11(13)17-5-7-3-15-7/h6-9H,1-5H2 |
| InChIKey | DLTBOMSDLGUXHB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|