C14H18O6 — CID 87480134
bis(oxiran-2-ylmethyl) cyclohex-4-ene-1,3-dicarboxylate (PubChem CID 87480134) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) cyclohex-4-ene-1,3-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) cyclohex-4-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 87480134 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | bis(oxiran-2-ylmethyl) cyclohex-4-ene-1,3-dicarboxylate |
| SMILES | O=C(OCC1CO1)C1C=CCC(C(=O)OCC2CO2)C1 |
| InChI | InChI=1S/C14H18O6/c15-13(19-7-11-5-17-11)9-2-1-3-10(4-9)14(16)20-8-12-6-18-12/h1-2,9-12H,3-8H2 |
| InChIKey | DBGAGHYTMCSLNQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|