C12H14O5 — CID 151273172
5-methylidene-6-(oxiran-2-ylmethoxycarbonyl)cyclohex-2-ene-1-carboxylic acid (PubChem CID 151273172) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-methylidene-6-(oxiran-2-ylmethoxycarbonyl)cyclohex-2-ene-1-carboxylic acid.
| Compound Name | 5-methylidene-6-(oxiran-2-ylmethoxycarbonyl)cyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 151273172 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-methylidene-6-(oxiran-2-ylmethoxycarbonyl)cyclohex-2-ene-1-carboxylic acid |
| SMILES | C=C1CC=CC(C(=O)O)C1C(=O)OCC1CO1 |
| InChI | InChI=1S/C12H14O5/c1-7-3-2-4-9(11(13)14)10(7)12(15)17-6-8-5-16-8/h2,4,8-10H,1,3,5-6H2,(H,13,14) |
| InChIKey | NWUKPRBGAYUDMY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|