C21H20O4 — CID 87121058
oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)-3,3-diphenylprop-2-enoate (PubChem CID 87121058) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)-3,3-diphenylprop-2-enoate.
| Compound Name | oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 87121058 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | oxiran-2-ylmethyl 2-(oxiran-2-ylmethyl)-3,3-diphenylprop-2-enoate |
| SMILES | O=C(OCC1CO1)C(CC1CO1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20O4/c22-21(25-14-18-13-24-18)19(11-17-12-23-17)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | UPMCROPGQOLPNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|