About benzyl oxiran-2-ylmethyl carbonate
benzyl oxiran-2-ylmethyl carbonate (PubChem CID 88672245) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is benzyl oxiran-2-ylmethyl carbonate.
Molecular Properties
| Compound Name | benzyl oxiran-2-ylmethyl carbonate |
| PubChem CID | 88672245 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | benzyl oxiran-2-ylmethyl carbonate |
| SMILES | O=C(OCc1ccccc1)OCC1CO1 |
| InChI | InChI=1S/C11H12O4/c12-11(15-8-10-7-13-10)14-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | JZMZIXMKPZLDQB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze benzyl oxiran-2-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl oxiran-2-ylmethyl carbonate?
The IUPAC name of benzyl oxiran-2-ylmethyl carbonate (CID 88672245) is benzyl oxiran-2-ylmethyl carbonate.
What is the SMILES notation for benzyl oxiran-2-ylmethyl carbonate?
The canonical SMILES for benzyl oxiran-2-ylmethyl carbonate is O=C(OCc1ccccc1)OCC1CO1.
What is the InChIKey of benzyl oxiran-2-ylmethyl carbonate?
The InChIKey is JZMZIXMKPZLDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c12-11(15-8-10-7-13-10)14-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2.
What are the key properties of benzyl oxiran-2-ylmethyl carbonate?
benzyl oxiran-2-ylmethyl carbonate has a molecular weight of 208.21 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl oxiran-2-ylmethyl carbonate is sourced from PubChem (CID 88672245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).