C27H28F2O13 — CID 118108955
bis[[(2R,3R,4S)-4-fluoro-5-hydroxy-3-phenylmethoxycarbonyloxyoxolan-2-yl]methyl] carbonate (PubChem CID 118108955) has the molecular formula C27H28F2O13 and a molecular weight of 598.50 g/mol. Its IUPAC name is bis[[(2R,3R,4S)-4-fluoro-5-hydroxy-3-phenylmethoxycarbonyloxyoxolan-2-yl]methyl] carbonate.
| Compound Name | bis[[(2R,3R,4S)-4-fluoro-5-hydroxy-3-phenylmethoxycarbonyloxyoxolan-2-yl]methyl] carbonate |
|---|---|
| PubChem CID | 118108955 |
| Molecular Formula | C27H28F2O13 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | bis[[(2R,3R,4S)-4-fluoro-5-hydroxy-3-phenylmethoxycarbonyloxyoxolan-2-yl]methyl] carbonate |
| SMILES | O=C(OC[C@H]1OC(O)[C@@H](F)[C@@H]1OC(=O)OCc1ccccc1)OC[C@H]1OC(O)[C@@H](F)[C@@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H28F2O13/c28-19-21(41-26(33)35-11-15-7-3-1-4-8-15)17(39-23(19)30)13-37-25(32)38-14-18-22(20(29)24(31)40-18)42-27(34)36-12-16-9-5-2-6-10-16/h1-10,17-24,30-31H,11-14H2/t17-,18-,19+,20+,21-,22-,23?,24?/m1/s1 |
| InChIKey | QCQLMWIPNHBUIH-WKHQXQPASA-N |
| XLogP | 2.69 |
| TPSA | 165.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|