C19H19FO5 — CID 129152365
[(2R,3R,4R)-4-fluoro-5-hydroxy-3-phenylmethoxyoxolan-2-yl]methyl benzoate (PubChem CID 129152365) has the molecular formula C19H19FO5 and a molecular weight of 346.35 g/mol. Its IUPAC name is [(2R,3R,4R)-4-fluoro-5-hydroxy-3-phenylmethoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-4-fluoro-5-hydroxy-3-phenylmethoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 129152365 |
| Molecular Formula | C19H19FO5 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(2R,3R,4R)-4-fluoro-5-hydroxy-3-phenylmethoxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](F)[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19FO5/c20-16-17(23-11-13-7-3-1-4-8-13)15(25-19(16)22)12-24-18(21)14-9-5-2-6-10-14/h1-10,15-17,19,22H,11-12H2/t15-,16-,17-,19?/m1/s1 |
| InChIKey | BBMJKBYKPIUVPO-YIVKDGLNSA-N |
| XLogP | 2.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |