C35H32O10 — CID 171121872
[(2R,3S,4S,5R,6R)-3,5-dibenzoyloxy-6-hydroxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl benzoate (PubChem CID 171121872) has the molecular formula C35H32O10 and a molecular weight of 612.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5-dibenzoyloxy-6-hydroxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5-dibenzoyloxy-6-hydroxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 171121872 |
| Molecular Formula | C35H32O10 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5-dibenzoyloxy-6-hydroxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]methyl benzoate |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OC(=O)c3ccccc3)[C@H](O)O[C@H](COC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32O10/c1-40-27-19-17-23(18-20-27)21-41-30-29(44-33(37)25-13-7-3-8-14-25)28(22-42-32(36)24-11-5-2-6-12-24)43-35(39)31(30)45-34(38)26-15-9-4-10-16-26/h2-20,28-31,35,39H,21-22H2,1H3/t28-,29+,30+,31-,35-/m1/s1 |
| InChIKey | GTWPQHNAVGSQMD-DKEJUXQPSA-N |
| XLogP | 4.61 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|