C32H34O10 — CID 174321348
[(3S,6R)-3-benzoyloxy-6-hydroxy-4-(4-hydroxypentanoyloxy)-5-phenylmethoxyoxan-2-yl]methyl benzoate (PubChem CID 174321348) has the molecular formula C32H34O10 and a molecular weight of 578.61 g/mol. Its IUPAC name is [(3S,6R)-3-benzoyloxy-6-hydroxy-4-(4-hydroxypentanoyloxy)-5-phenylmethoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3S,6R)-3-benzoyloxy-6-hydroxy-4-(4-hydroxypentanoyloxy)-5-phenylmethoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 174321348 |
| Molecular Formula | C32H34O10 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [(3S,6R)-3-benzoyloxy-6-hydroxy-4-(4-hydroxypentanoyloxy)-5-phenylmethoxyoxan-2-yl]methyl benzoate |
| SMILES | CC(O)CCC(=O)OC1C(OCc2ccccc2)[C@H](O)OC(COC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H34O10/c1-21(33)17-18-26(34)41-28-27(42-31(36)24-15-9-4-10-16-24)25(20-39-30(35)23-13-7-3-8-14-23)40-32(37)29(28)38-19-22-11-5-2-6-12-22/h2-16,21,25,27-29,32-33,37H,17-20H2,1H3/t21?,25?,27-,28?,29?,32+/m0/s1 |
| InChIKey | VWHQWGLZCBZOSP-KSMFNXJNSA-N |
| XLogP | 3.44 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|