C39H38O10S — CID 11193322
[(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[(4-methoxyphenyl)methoxy]-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 11193322) has the molecular formula C39H38O10S and a molecular weight of 698.79 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[(4-methoxyphenyl)methoxy]-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[(4-methoxyphenyl)methoxy]-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11193322 |
| Molecular Formula | C39H38O10S |
| Molecular Weight | 698.79 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-benzoyloxy-4-[(4-methoxyphenyl)methoxy]-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OC(=O)CCC(C)=O)[C@@H](COC(=O)c3ccccc3)O[C@@H](Sc3ccccc3)[C@@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H38O10S/c1-26(40)18-23-33(41)48-34-32(25-46-37(42)28-12-6-3-7-13-28)47-39(50-31-16-10-5-11-17-31)36(49-38(43)29-14-8-4-9-15-29)35(34)45-24-27-19-21-30(44-2)22-20-27/h3-17,19-22,32,34-36,39H,18,23-25H2,1-2H3/t32-,34+,35+,36-,39+/m1/s1 |
| InChIKey | BKLBFHFPWZVXNK-TWGPWLPGSA-N |
| XLogP | 6.46 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.79 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|