C25H27F3O10S2 — CID 10507922
[(2R,3R,4S,5S,6S)-3-acetyloxy-4-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate (PubChem CID 10507922) has the molecular formula C25H27F3O10S2 and a molecular weight of 608.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3-acetyloxy-4-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3-acetyloxy-4-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10507922 |
| Molecular Formula | C25H27F3O10S2 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3-acetyloxy-4-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(CO[C@H]2[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H](Sc3ccccc3)[C@H]2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27F3O10S2/c1-15(29)34-14-20-21(36-16(2)30)22(35-13-17-9-11-18(33-3)12-10-17)23(38-40(31,32)25(26,27)28)24(37-20)39-19-7-5-4-6-8-19/h4-12,20-24H,13-14H2,1-3H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | PDEHJPLJKMCBLO-DJCPXJLLSA-N |
| XLogP | 3.83 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|