C49H48O7S — CID 102454378
[(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)-diphenylmethyl]sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 102454378) has the molecular formula C49H48O7S and a molecular weight of 780.98 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)-diphenylmethyl]sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)-diphenylmethyl]sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102454378 |
| Molecular Formula | C49H48O7S |
| Molecular Weight | 780.98 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(4-methoxyphenyl)-diphenylmethyl]sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(C(S[C@H]2O[C@H](COC(C)=O)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H48O7S/c1-36(50)52-35-44-45(53-32-37-18-8-3-9-19-37)46(54-33-38-20-10-4-11-21-38)47(55-34-39-22-12-5-13-23-39)48(56-44)57-49(40-24-14-6-15-25-40,41-26-16-7-17-27-41)42-28-30-43(51-2)31-29-42/h3-31,44-48H,32-35H2,1-2H3/t44-,45-,46+,47-,48-/m1/s1 |
| InChIKey | ANWLGLCCGINALI-UHKSOEAPSA-N |
| XLogP | 9.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.98 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|