C25H28O10 — CID 171123191
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl] benzoate (PubChem CID 171123191) has the molecular formula C25H28O10 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 171123191 |
| Molecular Formula | C25H28O10 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]oxan-3-yl] benzoate |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O10/c1-15(26)32-22-21(35-24(28)18-7-5-4-6-8-18)20(34-25(29)23(22)33-16(2)27)14-31-13-17-9-11-19(30-3)12-10-17/h4-12,20-23,25,29H,13-14H2,1-3H3/t20-,21-,22+,23-,25-/m1/s1 |
| InChIKey | RNEKPPMUCXSMJX-MXCHMSEPSA-N |
| XLogP | 2.02 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|