C12H13FO5 — CID 175174191
[(2R,3R,4S)-3-fluoro-4,5-dihydroxyoxolan-2-yl]methyl benzoate (PubChem CID 175174191) has the molecular formula C12H13FO5 and a molecular weight of 256.23 g/mol. Its IUPAC name is [(2R,3R,4S)-3-fluoro-4,5-dihydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S)-3-fluoro-4,5-dihydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 175174191 |
| Molecular Formula | C12H13FO5 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [(2R,3R,4S)-3-fluoro-4,5-dihydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](O)[C@H]1F)c1ccccc1 |
| InChI | InChI=1S/C12H13FO5/c13-9-8(18-12(16)10(9)14)6-17-11(15)7-4-2-1-3-5-7/h1-5,8-10,12,14,16H,6H2/t8-,9+,10-,12?/m1/s1 |
| InChIKey | FKJAOLJOKMSDDV-SMRSKGNSSA-N |
| XLogP | 0.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |