C12H11FO5 — CID 71044137
[(2R)-4-fluoro-3-hydroxy-5-oxooxolan-2-yl]methyl benzoate (PubChem CID 71044137) has the molecular formula C12H11FO5 and a molecular weight of 254.21 g/mol. Its IUPAC name is [(2R)-4-fluoro-3-hydroxy-5-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R)-4-fluoro-3-hydroxy-5-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71044137 |
| Molecular Formula | C12H11FO5 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [(2R)-4-fluoro-3-hydroxy-5-oxooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(=O)C(F)C1O)c1ccccc1 |
| InChI | InChI=1S/C12H11FO5/c13-9-10(14)8(18-12(9)16)6-17-11(15)7-4-2-1-3-5-7/h1-5,8-10,14H,6H2/t8-,9?,10?/m1/s1 |
| InChIKey | PQSHNAOLXMQFGQ-XNWIYYODSA-N |
| XLogP | 0.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |