C13H10BiF2O6 — CID 162141889
CID 162141889 (PubChem CID 162141889) has the molecular formula C13H10BiF2O6 and a molecular weight of 509.19 g/mol.
| Compound Name | CID 162141889 |
|---|---|
| PubChem CID | 162141889 |
| Molecular Formula | C13H10BiF2O6 |
| Molecular Weight | 509.19 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | — |
| SMILES | O=C([BiH])OC1[C@@H](COC(=O)c2ccccc2)OC(=O)C1(F)F |
| InChI | InChI=1S/C13H9F2O6.Bi.H/c14-13(15)10(20-7-16)9(21-12(13)18)6-19-11(17)8-4-2-1-3-5-8;;/h1-5,9-10H,6H2;;/t9-,10?;;/m1../s1 |
| InChIKey | WVILNNSZRXSGFQ-BFBVBPSISA-N |
| XLogP | 0.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|