C20H18BrFO5 — CID 59583577
[(3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 59583577) has the molecular formula C20H18BrFO5 and a molecular weight of 437.26 g/mol. Its IUPAC name is [(3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59583577 |
| Molecular Formula | C20H18BrFO5 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [(3R,4R,5R)-3-benzoyloxy-5-bromo-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(F)[C@H](OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)O[C@@H]1Br |
| InChI | InChI=1S/C20H18BrFO5/c1-20(22)16(27-18(24)14-10-6-3-7-11-14)15(26-19(20)21)12-25-17(23)13-8-4-2-5-9-13/h2-11,15-16,19H,12H2,1H3/t15?,16-,19+,20-/m1/s1 |
| InChIKey | BXKUNDXPWMNAMP-PWDJPSRWSA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|