C25H29FO5 — CID 130403763
(3-benzoyloxy-4-fluoro-4-methyl-5-pentyloxolan-2-yl)methyl benzoate (PubChem CID 130403763) has the molecular formula C25H29FO5 and a molecular weight of 428.50 g/mol. Its IUPAC name is (3-benzoyloxy-4-fluoro-4-methyl-5-pentyloxolan-2-yl)methyl benzoate.
| Compound Name | (3-benzoyloxy-4-fluoro-4-methyl-5-pentyloxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 130403763 |
| Molecular Formula | C25H29FO5 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (3-benzoyloxy-4-fluoro-4-methyl-5-pentyloxolan-2-yl)methyl benzoate |
| SMILES | CCCCCC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1(C)F |
| InChI | InChI=1S/C25H29FO5/c1-3-4-7-16-21-25(2,26)22(31-24(28)19-14-10-6-11-15-19)20(30-21)17-29-23(27)18-12-8-5-9-13-18/h5-6,8-15,20-22H,3-4,7,16-17H2,1-2H3 |
| InChIKey | FYYMENNOYCJXIJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|