C19H14F2O6 — CID 45038807
[(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate (PubChem CID 45038807) has the molecular formula C19H14F2O6 and a molecular weight of 376.31 g/mol. Its IUPAC name is [(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 45038807 |
| Molecular Formula | C19H14F2O6 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [(2R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(=O)C(F)(F)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-,15?/m1/s1 |
| InChIKey | SHHNEUNVMZNOID-GICMACPYSA-N |
| XLogP | 2.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|