C26H20BrFO8 — CID 175732918
[(2R,3R,4R)-3,5-dibenzoyloxy-5-bromo-4-(18F)fluoro-4-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 175732918) has the molecular formula C26H20BrFO8 and a molecular weight of 558.34 g/mol. Its IUPAC name is [(2R,3R,4R)-3,5-dibenzoyloxy-5-bromo-4-(18F)fluoro-4-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,5-dibenzoyloxy-5-bromo-4-(18F)fluoro-4-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 175732918 |
| Molecular Formula | C26H20BrFO8 |
| Molecular Weight | 558.34 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | [(2R,3R,4R)-3,5-dibenzoyloxy-5-bromo-4-(18F)fluoro-4-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(Br)(OC(=O)c2ccccc2)[C@](O)([18F])[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20BrFO8/c27-26(36-24(31)19-14-8-3-9-15-19)25(28,32)21(34-23(30)18-12-6-2-7-13-18)20(35-26)16-33-22(29)17-10-4-1-5-11-17/h1-15,20-21,32H,16H2/t20-,21-,25+,26?/m1/s1/i28-1 |
| InChIKey | YTIYLKZGYINMFM-LMRUPBNCSA-N |
| XLogP | 4.03 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|