C35H28BrNO10 — CID 85352243
(3,4,5-tribenzoyloxy-6-bromo-6-carbamoyloxan-2-yl)methyl benzoate (PubChem CID 85352243) has the molecular formula C35H28BrNO10 and a molecular weight of 702.51 g/mol. Its IUPAC name is (3,4,5-tribenzoyloxy-6-bromo-6-carbamoyloxan-2-yl)methyl benzoate.
| Compound Name | (3,4,5-tribenzoyloxy-6-bromo-6-carbamoyloxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 85352243 |
| Molecular Formula | C35H28BrNO10 |
| Molecular Weight | 702.51 g/mol |
| Exact Mass | 701.09 |
| IUPAC Name | (3,4,5-tribenzoyloxy-6-bromo-6-carbamoyloxan-2-yl)methyl benzoate |
| SMILES | NC(=O)C1(Br)OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H28BrNO10/c36-35(34(37)42)29(46-33(41)25-19-11-4-12-20-25)28(45-32(40)24-17-9-3-10-18-24)27(44-31(39)23-15-7-2-8-16-23)26(47-35)21-43-30(38)22-13-5-1-6-14-22/h1-20,26-29H,21H2,(H2,37,42) |
| InChIKey | JLJFLPFAJUXAPY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|