C35H26BrNO9 — CID 11399745
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-bromo-6-cyanooxan-2-yl]methyl benzoate (PubChem CID 11399745) has the molecular formula C35H26BrNO9 and a molecular weight of 684.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-bromo-6-cyanooxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-bromo-6-cyanooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11399745 |
| Molecular Formula | C35H26BrNO9 |
| Molecular Weight | 684.50 g/mol |
| Exact Mass | 683.08 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-bromo-6-cyanooxan-2-yl]methyl benzoate |
| SMILES | N#C[C@]1(Br)O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H26BrNO9/c36-35(22-37)30(45-34(41)26-19-11-4-12-20-26)29(44-33(40)25-17-9-3-10-18-25)28(43-32(39)24-15-7-2-8-16-24)27(46-35)21-42-31(38)23-13-5-1-6-14-23/h1-20,27-30H,21H2/t27-,28-,29+,30-,35+/m1/s1 |
| InChIKey | OHKNUKSZCBYQIZ-HOUGBNEZSA-N |
| XLogP | 5.53 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|