C40H32O10S — CID 101395080
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 101395080) has the molecular formula C40H32O10S and a molecular weight of 704.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101395080 |
| Molecular Formula | C40H32O10S |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-hydroxy-6-phenylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@](O)(Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32O10S/c41-36(27-16-6-1-7-17-27)46-26-32-33(47-37(42)28-18-8-2-9-19-28)34(48-38(43)29-20-10-3-11-21-29)35(49-39(44)30-22-12-4-13-23-30)40(45,50-32)51-31-24-14-5-15-25-31/h1-25,32-35,45H,26H2/t32-,33-,34+,35-,40+/m1/s1 |
| InChIKey | MBWYKTBYASCSFF-VWJQFIRJSA-N |
| XLogP | 6.36 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|