C28H22N2O9 — CID 134847513
(8,9-dibenzoyloxy-2,3-dioxo-6-oxa-1,4-diazaspiro[4.4]nonan-7-yl)methyl benzoate (PubChem CID 134847513) has the molecular formula C28H22N2O9 and a molecular weight of 530.49 g/mol. Its IUPAC name is (8,9-dibenzoyloxy-2,3-dioxo-6-oxa-1,4-diazaspiro[4.4]nonan-7-yl)methyl benzoate.
| Compound Name | (8,9-dibenzoyloxy-2,3-dioxo-6-oxa-1,4-diazaspiro[4.4]nonan-7-yl)methyl benzoate |
|---|---|
| PubChem CID | 134847513 |
| Molecular Formula | C28H22N2O9 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (8,9-dibenzoyloxy-2,3-dioxo-6-oxa-1,4-diazaspiro[4.4]nonan-7-yl)methyl benzoate |
| SMILES | O=C1NC2(NC1=O)OC(COC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H22N2O9/c31-23-24(32)30-28(29-23)22(38-27(35)19-14-8-3-9-15-19)21(37-26(34)18-12-6-2-7-13-18)20(39-28)16-36-25(33)17-10-4-1-5-11-17/h1-15,20-22H,16H2,(H,29,31)(H,30,32) |
| InChIKey | HSFWSXNGBICHIK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|