C21H21FO8S — CID 118930469
(3-benzoyloxy-4-fluoro-4-methyl-5-methylsulfonyloxyoxolan-2-yl)methyl benzoate (PubChem CID 118930469) has the molecular formula C21H21FO8S and a molecular weight of 452.46 g/mol. Its IUPAC name is (3-benzoyloxy-4-fluoro-4-methyl-5-methylsulfonyloxyoxolan-2-yl)methyl benzoate.
| Compound Name | (3-benzoyloxy-4-fluoro-4-methyl-5-methylsulfonyloxyoxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 118930469 |
| Molecular Formula | C21H21FO8S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (3-benzoyloxy-4-fluoro-4-methyl-5-methylsulfonyloxyoxolan-2-yl)methyl benzoate |
| SMILES | CC1(F)C(OS(C)(=O)=O)OC(COC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21FO8S/c1-21(22)17(29-19(24)15-11-7-4-8-12-15)16(28-20(21)30-31(2,25)26)13-27-18(23)14-9-5-3-6-10-14/h3-12,16-17,20H,13H2,1-2H3 |
| InChIKey | MJKUQQKDSBNXHS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|