C32H26F2O8S — CID 87481200
[(2R,3R)-4,4-difluoro-5-methylsulfonyloxy-3-(4-phenylbenzoyl)oxyoxolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 87481200) has the molecular formula C32H26F2O8S and a molecular weight of 608.62 g/mol. Its IUPAC name is [(2R,3R)-4,4-difluoro-5-methylsulfonyloxy-3-(4-phenylbenzoyl)oxyoxolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2R,3R)-4,4-difluoro-5-methylsulfonyloxy-3-(4-phenylbenzoyl)oxyoxolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 87481200 |
| Molecular Formula | C32H26F2O8S |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | [(2R,3R)-4,4-difluoro-5-methylsulfonyloxy-3-(4-phenylbenzoyl)oxyoxolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | CS(=O)(=O)OC1O[C@H](COC(=O)c2ccc(-c3ccccc3)cc2)[C@@H](OC(=O)c2ccc(-c3ccccc3)cc2)C1(F)F |
| InChI | InChI=1S/C32H26F2O8S/c1-43(37,38)42-31-32(33,34)28(41-30(36)26-18-14-24(15-19-26)22-10-6-3-7-11-22)27(40-31)20-39-29(35)25-16-12-23(13-17-25)21-8-4-2-5-9-21/h2-19,27-28,31H,20H2,1H3/t27-,28-,31?/m1/s1 |
| InChIKey | JQEIYFOVMWTCSI-GSHKWTBTSA-N |
| XLogP | 5.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|