C34H38F2O8S — CID 10897557
[(2R,3R)-3-benzoyloxy-4,4-difluoro-5-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyoxolan-2-yl]methyl benzoate (PubChem CID 10897557) has the molecular formula C34H38F2O8S and a molecular weight of 644.73 g/mol. Its IUPAC name is [(2R,3R)-3-benzoyloxy-4,4-difluoro-5-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R)-3-benzoyloxy-4,4-difluoro-5-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10897557 |
| Molecular Formula | C34H38F2O8S |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | [(2R,3R)-3-benzoyloxy-4,4-difluoro-5-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)OC2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)C2(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C34H38F2O8S/c1-20(2)25-17-26(21(3)4)29(27(18-25)22(5)6)45(39,40)44-33-34(35,36)30(43-32(38)24-15-11-8-12-16-24)28(42-33)19-41-31(37)23-13-9-7-10-14-23/h7-18,20-22,28,30,33H,19H2,1-6H3/t28-,30-,33?/m1/s1 |
| InChIKey | CVTIRNYQSXDBTP-PCGYVIRFSA-N |
| XLogP | 7.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|