C26H20F2O7 — CID 141214431
[(2R,3R,5R)-3,5-dibenzoyloxy-4,4-difluorooxolan-2-yl]methyl benzoate (PubChem CID 141214431) has the molecular formula C26H20F2O7 and a molecular weight of 482.44 g/mol. Its IUPAC name is [(2R,3R,5R)-3,5-dibenzoyloxy-4,4-difluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,5R)-3,5-dibenzoyloxy-4,4-difluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 141214431 |
| Molecular Formula | C26H20F2O7 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [(2R,3R,5R)-3,5-dibenzoyloxy-4,4-difluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OC(=O)c2ccccc2)C(F)(F)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20F2O7/c27-26(28)21(34-23(30)18-12-6-2-7-13-18)20(16-32-22(29)17-10-4-1-5-11-17)33-25(26)35-24(31)19-14-8-3-9-15-19/h1-15,20-21,25H,16H2/t20-,21-,25-/m1/s1 |
| InChIKey | MPNSCBNCZSJEJG-DNRQZRRGSA-N |
| XLogP | 4.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|