C28H22O8 — CID 123913248
(3,5-dibenzoyloxy-4-ethynyl-4-hydroxyoxolan-2-yl)methyl benzoate (PubChem CID 123913248) has the molecular formula C28H22O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is (3,5-dibenzoyloxy-4-ethynyl-4-hydroxyoxolan-2-yl)methyl benzoate.
| Compound Name | (3,5-dibenzoyloxy-4-ethynyl-4-hydroxyoxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 123913248 |
| Molecular Formula | C28H22O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (3,5-dibenzoyloxy-4-ethynyl-4-hydroxyoxolan-2-yl)methyl benzoate |
| SMILES | C#CC1(O)C(OC(=O)c2ccccc2)OC(COC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H22O8/c1-2-28(32)23(35-25(30)20-14-8-4-9-15-20)22(18-33-24(29)19-12-6-3-7-13-19)34-27(28)36-26(31)21-16-10-5-11-17-21/h1,3-17,22-23,27,32H,18H2 |
| InChIKey | WGLJCEFHNZMBRH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|