C28H24O9 — CID 22896141
[(2S,3S,4S)-5-acetyloxy-4-benzoyl-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 22896141) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is [(2S,3S,4S)-5-acetyloxy-4-benzoyl-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4S)-5-acetyloxy-4-benzoyl-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22896141 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [(2S,3S,4S)-5-acetyloxy-4-benzoyl-3-benzoyloxy-4-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)OC1O[C@@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H24O9/c1-18(29)35-27-28(33,23(30)19-11-5-2-6-12-19)24(37-26(32)21-15-9-4-10-16-21)22(36-27)17-34-25(31)20-13-7-3-8-14-20/h2-16,22,24,27,33H,17H2,1H3/t22-,24-,27?,28-/m0/s1 |
| InChIKey | RHZLSDMPCYMDBS-QKKKVNQJSA-N |
| XLogP | 2.97 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|